C9H14N6O2 — CID 83106538
4-(6-hydrazinylpyrazin-2-yl)morpholine-3-carboxamide (PubChem CID 83106538) has the molecular formula C9H14N6O2 and a molecular weight of 238.25 g/mol. Its IUPAC name is 4-(6-hydrazinylpyrazin-2-yl)morpholine-3-carboxamide.
| Compound Name | 4-(6-hydrazinylpyrazin-2-yl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83106538 |
| Molecular Formula | C9H14N6O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 4-(6-hydrazinylpyrazin-2-yl)morpholine-3-carboxamide |
| SMILES | NNc1cncc(N2CCOCC2C(N)=O)n1 |
| InChI | InChI=1S/C9H14N6O2/c10-9(16)6-5-17-2-1-15(6)8-4-12-3-7(13-8)14-11/h3-4,6H,1-2,5,11H2,(H2,10,16)(H,13,14) |
| InChIKey | OJJFNFWDFYYQEM-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|