C10H16N6O2S — CID 83107029
4-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)morpholine-3-carboxamide (PubChem CID 83107029) has the molecular formula C10H16N6O2S and a molecular weight of 284.35 g/mol. Its IUPAC name is 4-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)morpholine-3-carboxamide.
| Compound Name | 4-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83107029 |
| Molecular Formula | C10H16N6O2S |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 4-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)morpholine-3-carboxamide |
| SMILES | CSc1nc(NN)cc(N2CCOCC2C(N)=O)n1 |
| InChI | InChI=1S/C10H16N6O2S/c1-19-10-13-7(15-12)4-8(14-10)16-2-3-18-5-6(16)9(11)17/h4,6H,2-3,5,12H2,1H3,(H2,11,17)(H,13,14,15) |
| InChIKey | GOJVWSLRSBUABQ-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|