C10H17N5S — CID 80898992
[6-(2-methylpyrrolidin-1-yl)-2-methylsulfanylpyrimidin-4-yl]hydrazine (PubChem CID 80898992) has the molecular formula C10H17N5S and a molecular weight of 239.35 g/mol. Its IUPAC name is [6-(2-methylpyrrolidin-1-yl)-2-methylsulfanylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-(2-methylpyrrolidin-1-yl)-2-methylsulfanylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80898992 |
| Molecular Formula | C10H17N5S |
| Molecular Weight | 239.35 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | [6-(2-methylpyrrolidin-1-yl)-2-methylsulfanylpyrimidin-4-yl]hydrazine |
| SMILES | CSc1nc(NN)cc(N2CCCC2C)n1 |
| InChI | InChI=1S/C10H17N5S/c1-7-4-3-5-15(7)9-6-8(14-11)12-10(13-9)16-2/h6-7H,3-5,11H2,1-2H3,(H,12,13,14) |
| InChIKey | GOQUECJJGRWGRB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|