C9H15N5S2 — CID 80932159
(2-methylsulfanyl-6-thiomorpholin-4-ylpyrimidin-4-yl)hydrazine (PubChem CID 80932159) has the molecular formula C9H15N5S2 and a molecular weight of 257.39 g/mol. Its IUPAC name is (2-methylsulfanyl-6-thiomorpholin-4-ylpyrimidin-4-yl)hydrazine.
| Compound Name | (2-methylsulfanyl-6-thiomorpholin-4-ylpyrimidin-4-yl)hydrazine |
|---|---|
| PubChem CID | 80932159 |
| Molecular Formula | C9H15N5S2 |
| Molecular Weight | 257.39 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | (2-methylsulfanyl-6-thiomorpholin-4-ylpyrimidin-4-yl)hydrazine |
| SMILES | CSc1nc(NN)cc(N2CCSCC2)n1 |
| InChI | InChI=1S/C9H15N5S2/c1-15-9-11-7(13-10)6-8(12-9)14-2-4-16-5-3-14/h6H,2-5,10H2,1H3,(H,11,12,13) |
| InChIKey | GNIRQKOKDVTXBK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.39 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|