C9H15N5S — CID 80765741
4-N-methyl-6-thiomorpholin-4-ylpyrimidine-2,4-diamine (PubChem CID 80765741) has the molecular formula C9H15N5S and a molecular weight of 225.32 g/mol. Its IUPAC name is 4-N-methyl-6-thiomorpholin-4-ylpyrimidine-2,4-diamine.
| Compound Name | 4-N-methyl-6-thiomorpholin-4-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80765741 |
| Molecular Formula | C9H15N5S |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 4-N-methyl-6-thiomorpholin-4-ylpyrimidine-2,4-diamine |
| SMILES | CNc1cc(N2CCSCC2)nc(N)n1 |
| InChI | InChI=1S/C9H15N5S/c1-11-7-6-8(13-9(10)12-7)14-2-4-15-5-3-14/h6H,2-5H2,1H3,(H3,10,11,12,13) |
| InChIKey | CIYZPLLBQZHDLO-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |