C9H15N5O — CID 80767642
4-N-methyl-6-morpholin-4-ylpyrimidine-2,4-diamine (PubChem CID 80767642) has the molecular formula C9H15N5O and a molecular weight of 209.25 g/mol. Its IUPAC name is 4-N-methyl-6-morpholin-4-ylpyrimidine-2,4-diamine.
| Compound Name | 4-N-methyl-6-morpholin-4-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80767642 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 4-N-methyl-6-morpholin-4-ylpyrimidine-2,4-diamine |
| SMILES | CNc1cc(N2CCOCC2)nc(N)n1 |
| InChI | InChI=1S/C9H15N5O/c1-11-7-6-8(13-9(10)12-7)14-2-4-15-5-3-14/h6H,2-5H2,1H3,(H3,10,11,12,13) |
| InChIKey | AXNKRMOVKAQSAE-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |