C12H21N5S — CID 80796760
4-N-propyl-6-(1,4-thiazepan-4-yl)pyrimidine-2,4-diamine (PubChem CID 80796760) has the molecular formula C12H21N5S and a molecular weight of 267.40 g/mol. Its IUPAC name is 4-N-propyl-6-(1,4-thiazepan-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-propyl-6-(1,4-thiazepan-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80796760 |
| Molecular Formula | C12H21N5S |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 4-N-propyl-6-(1,4-thiazepan-4-yl)pyrimidine-2,4-diamine |
| SMILES | CCCNc1cc(N2CCCSCC2)nc(N)n1 |
| InChI | InChI=1S/C12H21N5S/c1-2-4-14-10-9-11(16-12(13)15-10)17-5-3-7-18-8-6-17/h9H,2-8H2,1H3,(H3,13,14,15,16) |
| InChIKey | UWHJOVXSYAVQAX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |