C12H20N6O — CID 80843065
4-[2-amino-6-(propylamino)pyrimidin-4-yl]-1,4-diazepan-2-one (PubChem CID 80843065) has the molecular formula C12H20N6O and a molecular weight of 264.33 g/mol. Its IUPAC name is 4-[2-amino-6-(propylamino)pyrimidin-4-yl]-1,4-diazepan-2-one.
| Compound Name | 4-[2-amino-6-(propylamino)pyrimidin-4-yl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 80843065 |
| Molecular Formula | C12H20N6O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 4-[2-amino-6-(propylamino)pyrimidin-4-yl]-1,4-diazepan-2-one |
| SMILES | CCCNc1cc(N2CCCNC(=O)C2)nc(N)n1 |
| InChI | InChI=1S/C12H20N6O/c1-2-4-14-9-7-10(17-12(13)16-9)18-6-3-5-15-11(19)8-18/h7H,2-6,8H2,1H3,(H,15,19)(H3,13,14,16,17) |
| InChIKey | FESFLMAJSXCBHA-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |