C10H18N6 — CID 67157216
6-(3-aminoazetidin-1-yl)-4-N-propylpyrimidine-2,4-diamine (PubChem CID 67157216) has the molecular formula C10H18N6 and a molecular weight of 222.30 g/mol. Its IUPAC name is 6-(3-aminoazetidin-1-yl)-4-N-propylpyrimidine-2,4-diamine.
| Compound Name | 6-(3-aminoazetidin-1-yl)-4-N-propylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 67157216 |
| Molecular Formula | C10H18N6 |
| Molecular Weight | 222.30 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 6-(3-aminoazetidin-1-yl)-4-N-propylpyrimidine-2,4-diamine |
| SMILES | CCCNc1cc(N2CC(N)C2)nc(N)n1 |
| InChI | InChI=1S/C10H18N6/c1-2-3-13-8-4-9(15-10(12)14-8)16-5-7(11)6-16/h4,7H,2-3,5-6,11H2,1H3,(H3,12,13,14,15) |
| InChIKey | SWQMTRAVIMPYPH-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.30 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |