C15H24N6 — CID 91427725
6-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-4-N-(cyclopropylmethyl)pyrimidine-2,4-diamine (PubChem CID 91427725) has the molecular formula C15H24N6 and a molecular weight of 288.40 g/mol. Its IUPAC name is 6-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-4-N-(cyclopropylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 6-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-4-N-(cyclopropylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 91427725 |
| Molecular Formula | C15H24N6 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 6-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-4-N-(cyclopropylmethyl)pyrimidine-2,4-diamine |
| SMILES | CN1C[C@@H]2CN(c3cc(NCC4CC4)nc(N)n3)C[C@@H]2C1 |
| InChI | InChI=1S/C15H24N6/c1-20-6-11-8-21(9-12(11)7-20)14-4-13(18-15(16)19-14)17-5-10-2-3-10/h4,10-12H,2-3,5-9H2,1H3,(H3,16,17,18,19)/t11-,12+ |
| InChIKey | BPOMOLPEBQWGCQ-TXEJJXNPSA-N |
| XLogP | 0.88 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |