C11H19N5 — CID 24996858
4-(3-aminoazetidin-1-yl)-6-tert-butylpyrimidin-2-amine (PubChem CID 24996858) has the molecular formula C11H19N5 and a molecular weight of 221.31 g/mol. Its IUPAC name is 4-(3-aminoazetidin-1-yl)-6-tert-butylpyrimidin-2-amine.
| Compound Name | 4-(3-aminoazetidin-1-yl)-6-tert-butylpyrimidin-2-amine |
|---|---|
| PubChem CID | 24996858 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 4-(3-aminoazetidin-1-yl)-6-tert-butylpyrimidin-2-amine |
| SMILES | CC(C)(C)c1cc(N2CC(N)C2)nc(N)n1 |
| InChI | InChI=1S/C11H19N5/c1-11(2,3)8-4-9(15-10(13)14-8)16-5-7(12)6-16/h4,7H,5-6,12H2,1-3H3,(H2,13,14,15) |
| InChIKey | XPMSZFQHMJGOER-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |