C10H13F3N4O — CID 114565679
[1-[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]pyrrolidin-3-yl]methanol (PubChem CID 114565679) has the molecular formula C10H13F3N4O and a molecular weight of 262.23 g/mol. Its IUPAC name is [1-[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]pyrrolidin-3-yl]methanol.
| Compound Name | [1-[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 114565679 |
| Molecular Formula | C10H13F3N4O |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | [1-[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]pyrrolidin-3-yl]methanol |
| SMILES | Nc1nc(N2CCC(CO)C2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H13F3N4O/c11-10(12,13)7-3-8(16-9(14)15-7)17-2-1-6(4-17)5-18/h3,6,18H,1-2,4-5H2,(H2,14,15,16) |
| InChIKey | ALGSRLIOPDYUAN-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |