C11H13F3N2O — CID 169180430
[(3R)-1-[6-(trifluoromethyl)-3-pyridinyl]pyrrolidin-3-yl]methanol (PubChem CID 169180430) has the molecular formula C11H13F3N2O and a molecular weight of 246.23 g/mol. Its IUPAC name is [(3R)-1-[6-(trifluoromethyl)-3-pyridinyl]pyrrolidin-3-yl]methanol.
| Compound Name | [(3R)-1-[6-(trifluoromethyl)-3-pyridinyl]pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 169180430 |
| Molecular Formula | C11H13F3N2O |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | [(3R)-1-[6-(trifluoromethyl)-3-pyridinyl]pyrrolidin-3-yl]methanol |
| SMILES | OC[C@@H]1CCN(c2ccc(C(F)(F)F)nc2)C1 |
| InChI | InChI=1S/C11H13F3N2O/c12-11(13,14)10-2-1-9(5-15-10)16-4-3-8(6-16)7-17/h1-2,5,8,17H,3-4,6-7H2/t8-/m1/s1 |
| InChIKey | SOSYZBXFJJBMKP-MRVPVSSYSA-N |
| XLogP | 1.92 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |