C11H14F3N3O — CID 26986145
[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]methanol (PubChem CID 26986145) has the molecular formula C11H14F3N3O and a molecular weight of 261.25 g/mol. Its IUPAC name is [1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]methanol.
| Compound Name | [1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 26986145 |
| Molecular Formula | C11H14F3N3O |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | [1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]methanol |
| SMILES | OCC1CCN(c2nccc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C11H14F3N3O/c12-11(13,14)9-1-4-15-10(16-9)17-5-2-8(7-18)3-6-17/h1,4,8,18H,2-3,5-7H2 |
| InChIKey | MUGMOWSJXRECDC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |