C13H14F3N5 — CID 51104267
2-[4-(1H-pyrazol-5-yl)piperidin-1-yl]-4-(trifluoromethyl)pyrimidine (PubChem CID 51104267) has the molecular formula C13H14F3N5 and a molecular weight of 297.28 g/mol. Its IUPAC name is 2-[4-(1H-pyrazol-5-yl)piperidin-1-yl]-4-(trifluoromethyl)pyrimidine.
| Compound Name | 2-[4-(1H-pyrazol-5-yl)piperidin-1-yl]-4-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 51104267 |
| Molecular Formula | C13H14F3N5 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2-[4-(1H-pyrazol-5-yl)piperidin-1-yl]-4-(trifluoromethyl)pyrimidine |
| SMILES | FC(F)(F)c1ccnc(N2CCC(c3ccn[nH]3)CC2)n1 |
| InChI | InChI=1S/C13H14F3N5/c14-13(15,16)11-2-5-17-12(19-11)21-7-3-9(4-8-21)10-1-6-18-20-10/h1-2,5-6,9H,3-4,7-8H2,(H,18,20) |
| InChIKey | VUBFLLVWWVXEFG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |