C14H15F3N6 — CID 126887197
N-[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]pyrimidin-4-amine (PubChem CID 126887197) has the molecular formula C14H15F3N6 and a molecular weight of 324.31 g/mol. Its IUPAC name is N-[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]pyrimidin-4-amine.
| Compound Name | N-[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 126887197 |
| Molecular Formula | C14H15F3N6 |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | N-[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]pyrimidin-4-amine |
| SMILES | FC(F)(F)c1ccnc(N2CCC(Nc3ccncn3)CC2)n1 |
| InChI | InChI=1S/C14H15F3N6/c15-14(16,17)11-1-6-19-13(22-11)23-7-3-10(4-8-23)21-12-2-5-18-9-20-12/h1-2,5-6,9-10H,3-4,7-8H2,(H,18,20,21) |
| InChIKey | VGZGVOQUPVACRJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |