C12H17F3N4O2S — CID 48736158
N-methyl-N-[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]methanesulfonamide (PubChem CID 48736158) has the molecular formula C12H17F3N4O2S and a molecular weight of 338.36 g/mol. Its IUPAC name is N-methyl-N-[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]methanesulfonamide.
| Compound Name | N-methyl-N-[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 48736158 |
| Molecular Formula | C12H17F3N4O2S |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | N-methyl-N-[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]methanesulfonamide |
| SMILES | CN(C1CCN(c2nccc(C(F)(F)F)n2)CC1)S(C)(=O)=O |
| InChI | InChI=1S/C12H17F3N4O2S/c1-18(22(2,20)21)9-4-7-19(8-5-9)11-16-6-3-10(17-11)12(13,14)15/h3,6,9H,4-5,7-8H2,1-2H3 |
| InChIKey | OHJCDQCHEQYXPJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |