C12H16F3N3O — CID 106747257
[1-[5-amino-2-(trifluoromethyl)-4-pyridinyl]piperidin-4-yl]methanol (PubChem CID 106747257) has the molecular formula C12H16F3N3O and a molecular weight of 275.27 g/mol. Its IUPAC name is [1-[5-amino-2-(trifluoromethyl)-4-pyridinyl]piperidin-4-yl]methanol.
| Compound Name | [1-[5-amino-2-(trifluoromethyl)-4-pyridinyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 106747257 |
| Molecular Formula | C12H16F3N3O |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | [1-[5-amino-2-(trifluoromethyl)-4-pyridinyl]piperidin-4-yl]methanol |
| SMILES | Nc1cnc(C(F)(F)F)cc1N1CCC(CO)CC1 |
| InChI | InChI=1S/C12H16F3N3O/c13-12(14,15)11-5-10(9(16)6-17-11)18-3-1-8(7-19)2-4-18/h5-6,8,19H,1-4,7,16H2 |
| InChIKey | UTLIONXEOKUMEF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |