C12H17F3N4 — CID 114565756
4-(3-ethylpyrrolidin-1-yl)-N-methyl-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 114565756) has the molecular formula C12H17F3N4 and a molecular weight of 274.29 g/mol. Its IUPAC name is 4-(3-ethylpyrrolidin-1-yl)-N-methyl-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-(3-ethylpyrrolidin-1-yl)-N-methyl-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 114565756 |
| Molecular Formula | C12H17F3N4 |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 4-(3-ethylpyrrolidin-1-yl)-N-methyl-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CCC1CCN(c2cc(C(F)(F)F)nc(NC)n2)C1 |
| InChI | InChI=1S/C12H17F3N4/c1-3-8-4-5-19(7-8)10-6-9(12(13,14)15)17-11(16-2)18-10/h6,8H,3-5,7H2,1-2H3,(H,16,17,18) |
| InChIKey | ZENLOKNSXGHDKZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |