C10H10F3N5O2 — CID 114565375
4-[2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-yl]piperazine-2,6-dione (PubChem CID 114565375) has the molecular formula C10H10F3N5O2 and a molecular weight of 289.22 g/mol. Its IUPAC name is 4-[2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-yl]piperazine-2,6-dione.
| Compound Name | 4-[2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-yl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 114565375 |
| Molecular Formula | C10H10F3N5O2 |
| Molecular Weight | 289.22 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 4-[2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-yl]piperazine-2,6-dione |
| SMILES | CNc1nc(N2CC(=O)NC(=O)C2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H10F3N5O2/c1-14-9-15-5(10(11,12)13)2-6(16-9)18-3-7(19)17-8(20)4-18/h2H,3-4H2,1H3,(H,14,15,16)(H,17,19,20) |
| InChIKey | VHYLPLNLGIIKDK-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.22 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|