C10H13F3N6O — CID 114567345
4-[2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-yl]-1,4-diazepan-2-one (PubChem CID 114567345) has the molecular formula C10H13F3N6O and a molecular weight of 290.25 g/mol. Its IUPAC name is 4-[2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-yl]-1,4-diazepan-2-one.
| Compound Name | 4-[2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-yl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 114567345 |
| Molecular Formula | C10H13F3N6O |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 4-[2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-yl]-1,4-diazepan-2-one |
| SMILES | NNc1nc(N2CCCNC(=O)C2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H13F3N6O/c11-10(12,13)6-4-7(17-9(16-6)18-14)19-3-1-2-15-8(20)5-19/h4H,1-3,5,14H2,(H,15,20)(H,16,17,18) |
| InChIKey | KIKLMUWCBDWIMF-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|