About 4-[2-tert-butyl-6-(methylamino)pyrimidin-4-yl]-1,4-diazepan-2-one
4-[2-tert-butyl-6-(methylamino)pyrimidin-4-yl]-1,4-diazepan-2-one (PubChem CID 80959348) has the molecular formula C14H23N5O
and a molecular weight of 277.37 g/mol. Its IUPAC name is 4-[2-tert-butyl-6-(methylamino)pyrimidin-4-yl]-1,4-diazepan-2-one.
Molecular Properties
| Compound Name | 4-[2-tert-butyl-6-(methylamino)pyrimidin-4-yl]-1,4-diazepan-2-one |
| PubChem CID | 80959348 |
| Molecular Formula | C14H23N5O |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | 4-[2-tert-butyl-6-(methylamino)pyrimidin-4-yl]-1,4-diazepan-2-one |
| SMILES | CNc1cc(N2CCCNC(=O)C2)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C14H23N5O/c1-14(2,3)13-17-10(15-4)8-11(18-13)19-7-5-6-16-12(20)9-19/h8H,5-7,9H2,1-4H3,(H,16,20)(H,15,17,18) |
| InChIKey | FVJVIKUCNBAGAO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-tert-butyl-6-(methylamino)pyrimidin-4-yl]-1,4-diazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-tert-butyl-6-(methylamino)pyrimidin-4-yl]-1,4-diazepan-2-one?
The IUPAC name of 4-[2-tert-butyl-6-(methylamino)pyrimidin-4-yl]-1,4-diazepan-2-one (CID 80959348) is 4-[2-tert-butyl-6-(methylamino)pyrimidin-4-yl]-1,4-diazepan-2-one.
What is the SMILES notation for 4-[2-tert-butyl-6-(methylamino)pyrimidin-4-yl]-1,4-diazepan-2-one?
The canonical SMILES for 4-[2-tert-butyl-6-(methylamino)pyrimidin-4-yl]-1,4-diazepan-2-one is CNc1cc(N2CCCNC(=O)C2)nc(C(C)(C)C)n1.
What is the InChIKey of 4-[2-tert-butyl-6-(methylamino)pyrimidin-4-yl]-1,4-diazepan-2-one?
The InChIKey is FVJVIKUCNBAGAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N5O/c1-14(2,3)13-17-10(15-4)8-11(18-13)19-7-5-6-16-12(20)9-19/h8H,5-7,9H2,1-4H3,(H,16,20)(H,15,17,18).
What are the key properties of 4-[2-tert-butyl-6-(methylamino)pyrimidin-4-yl]-1,4-diazepan-2-one?
4-[2-tert-butyl-6-(methylamino)pyrimidin-4-yl]-1,4-diazepan-2-one has a molecular weight of 277.37 g/mol, XLogP of 1.14, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-tert-butyl-6-(methylamino)pyrimidin-4-yl]-1,4-diazepan-2-one is sourced from PubChem (CID 80959348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).