About 4-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)-1,4-diazepan-2-one
4-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)-1,4-diazepan-2-one (PubChem CID 80931065) has the molecular formula C10H16N6OS
and a molecular weight of 268.35 g/mol. Its IUPAC name is 4-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)-1,4-diazepan-2-one.
Molecular Properties
| Compound Name | 4-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)-1,4-diazepan-2-one |
| PubChem CID | 80931065 |
| Molecular Formula | C10H16N6OS |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 4-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)-1,4-diazepan-2-one |
| SMILES | CSc1nc(NN)cc(N2CCCNC(=O)C2)n1 |
| InChI | InChI=1S/C10H16N6OS/c1-18-10-13-7(15-11)5-8(14-10)16-4-2-3-12-9(17)6-16/h5H,2-4,6,11H2,1H3,(H,12,17)(H,13,14,15) |
| InChIKey | ODLRFUVYNSYZOD-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)-1,4-diazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)-1,4-diazepan-2-one?
The IUPAC name of 4-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)-1,4-diazepan-2-one (CID 80931065) is 4-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)-1,4-diazepan-2-one.
What is the SMILES notation for 4-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)-1,4-diazepan-2-one?
The canonical SMILES for 4-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)-1,4-diazepan-2-one is CSc1nc(NN)cc(N2CCCNC(=O)C2)n1.
What is the InChIKey of 4-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)-1,4-diazepan-2-one?
The InChIKey is ODLRFUVYNSYZOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N6OS/c1-18-10-13-7(15-11)5-8(14-10)16-4-2-3-12-9(17)6-16/h5H,2-4,6,11H2,1H3,(H,12,17)(H,13,14,15).
What are the key properties of 4-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)-1,4-diazepan-2-one?
4-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)-1,4-diazepan-2-one has a molecular weight of 268.35 g/mol, XLogP of -0.19, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)-1,4-diazepan-2-one is sourced from PubChem (CID 80931065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).