C12H20N6OS — CID 80901943
1-[4-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone (PubChem CID 80901943) has the molecular formula C12H20N6OS and a molecular weight of 296.40 g/mol. Its IUPAC name is 1-[4-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 1-[4-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 80901943 |
| Molecular Formula | C12H20N6OS |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 1-[4-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone |
| SMILES | CSc1nc(NN)cc(N2CCCN(C(C)=O)CC2)n1 |
| InChI | InChI=1S/C12H20N6OS/c1-9(19)17-4-3-5-18(7-6-17)11-8-10(16-13)14-12(15-11)20-2/h8H,3-7,13H2,1-2H3,(H,14,15,16) |
| InChIKey | MDMYSFDCXBQRDP-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|