C9H15N7O2 — CID 80931369
4-(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)-1,4-diazepan-2-one (PubChem CID 80931369) has the molecular formula C9H15N7O2 and a molecular weight of 253.27 g/mol. Its IUPAC name is 4-(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)-1,4-diazepan-2-one.
| Compound Name | 4-(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 80931369 |
| Molecular Formula | C9H15N7O2 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 4-(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)-1,4-diazepan-2-one |
| SMILES | COc1nc(NN)nc(N2CCCNC(=O)C2)n1 |
| InChI | InChI=1S/C9H15N7O2/c1-18-9-13-7(15-10)12-8(14-9)16-4-2-3-11-6(17)5-16/h2-5,10H2,1H3,(H,11,17)(H,12,13,14,15) |
| InChIKey | WSDJJVGECFSPSJ-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 118.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|