C10H18N6OS — CID 80912272
[4-(2,6-dimethylthiomorpholin-4-yl)-6-methoxy-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80912272) has the molecular formula C10H18N6OS and a molecular weight of 270.36 g/mol. Its IUPAC name is [4-(2,6-dimethylthiomorpholin-4-yl)-6-methoxy-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(2,6-dimethylthiomorpholin-4-yl)-6-methoxy-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80912272 |
| Molecular Formula | C10H18N6OS |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | [4-(2,6-dimethylthiomorpholin-4-yl)-6-methoxy-1,3,5-triazin-2-yl]hydrazine |
| SMILES | COc1nc(NN)nc(N2CC(C)SC(C)C2)n1 |
| InChI | InChI=1S/C10H18N6OS/c1-6-4-16(5-7(2)18-6)9-12-8(15-11)13-10(14-9)17-3/h6-7H,4-5,11H2,1-3H3,(H,12,13,14,15) |
| InChIKey | UBNXLFUYSLQUGF-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|