C11H17N9S — CID 80906283
[4-(2,6-dimethylthiomorpholin-4-yl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80906283) has the molecular formula C11H17N9S and a molecular weight of 307.39 g/mol. Its IUPAC name is [4-(2,6-dimethylthiomorpholin-4-yl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(2,6-dimethylthiomorpholin-4-yl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80906283 |
| Molecular Formula | C11H17N9S |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | [4-(2,6-dimethylthiomorpholin-4-yl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]hydrazine |
| SMILES | CC1CN(c2nc(NN)nc(-n3cncn3)n2)CC(C)S1 |
| InChI | InChI=1S/C11H17N9S/c1-7-3-19(4-8(2)21-7)10-15-9(18-12)16-11(17-10)20-6-13-5-14-20/h5-8H,3-4,12H2,1-2H3,(H,15,16,17,18) |
| InChIKey | YDJKRXIFTKEJBN-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|