C12H19N9 — CID 80912010
[4-(3,5-dimethylpiperidin-1-yl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80912010) has the molecular formula C12H19N9 and a molecular weight of 289.35 g/mol. Its IUPAC name is [4-(3,5-dimethylpiperidin-1-yl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(3,5-dimethylpiperidin-1-yl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80912010 |
| Molecular Formula | C12H19N9 |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | [4-(3,5-dimethylpiperidin-1-yl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]hydrazine |
| SMILES | CC1CC(C)CN(c2nc(NN)nc(-n3cncn3)n2)C1 |
| InChI | InChI=1S/C12H19N9/c1-8-3-9(2)5-20(4-8)11-16-10(19-13)17-12(18-11)21-7-14-6-15-21/h6-9H,3-5,13H2,1-2H3,(H,16,17,18,19) |
| InChIKey | VWDXQOQFBARFLC-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|