C11H15N9O — CID 80925470
[4-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80925470) has the molecular formula C11H15N9O and a molecular weight of 289.30 g/mol. Its IUPAC name is [4-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80925470 |
| Molecular Formula | C11H15N9O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | [4-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]hydrazine |
| SMILES | NNc1nc(N2CC3CCC(C2)O3)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C11H15N9O/c12-18-9-15-10(17-11(16-9)20-6-13-5-14-20)19-3-7-1-2-8(4-19)21-7/h5-8H,1-4,12H2,(H,15,16,17,18) |
| InChIKey | OWQIHQAMQPZOJS-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 119.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|