C10H14N10O — CID 80910159
5-[[[4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]amino]methyl]pyrrolidin-2-one (PubChem CID 80910159) has the molecular formula C10H14N10O and a molecular weight of 290.29 g/mol. Its IUPAC name is 5-[[[4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]amino]methyl]pyrrolidin-2-one.
| Compound Name | 5-[[[4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]amino]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 80910159 |
| Molecular Formula | C10H14N10O |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 5-[[[4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]amino]methyl]pyrrolidin-2-one |
| SMILES | NNc1nc(NCC2CCC(=O)N2)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C10H14N10O/c11-19-9-16-8(13-3-6-1-2-7(21)15-6)17-10(18-9)20-5-12-4-14-20/h4-6H,1-3,11H2,(H,15,21)(H2,13,16,17,18,19) |
| InChIKey | OTEDTWBDWFXQBC-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 148.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|