C10H17N9O2 — CID 106311874
2-[3-[[4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]amino]propoxy]ethanol (PubChem CID 106311874) has the molecular formula C10H17N9O2 and a molecular weight of 295.31 g/mol. Its IUPAC name is 2-[3-[[4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]amino]propoxy]ethanol.
| Compound Name | 2-[3-[[4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]amino]propoxy]ethanol |
|---|---|
| PubChem CID | 106311874 |
| Molecular Formula | C10H17N9O2 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 2-[3-[[4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]amino]propoxy]ethanol |
| SMILES | NNc1nc(NCCCOCCO)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C10H17N9O2/c11-18-9-15-8(13-2-1-4-21-5-3-20)16-10(17-9)19-7-12-6-14-19/h6-7,20H,1-5,11H2,(H2,13,15,16,17,18) |
| InChIKey | YVGSGYJIPOAFPG-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 148.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|