C9H15N9OS — CID 113488474
4-hydrazinyl-N-(3-methylsulfinylpropyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine (PubChem CID 113488474) has the molecular formula C9H15N9OS and a molecular weight of 297.35 g/mol. Its IUPAC name is 4-hydrazinyl-N-(3-methylsulfinylpropyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-N-(3-methylsulfinylpropyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 113488474 |
| Molecular Formula | C9H15N9OS |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 4-hydrazinyl-N-(3-methylsulfinylpropyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
| SMILES | CS(=O)CCCNc1nc(NN)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C9H15N9OS/c1-20(19)4-2-3-12-7-14-8(17-10)16-9(15-7)18-6-11-5-13-18/h5-6H,2-4,10H2,1H3,(H2,12,14,15,16,17) |
| InChIKey | FXLCEMJNPYYBPM-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 136.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|