C10H17N9 — CID 80919626
4-hydrazinyl-N-(2-methylbutyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine (PubChem CID 80919626) has the molecular formula C10H17N9 and a molecular weight of 263.31 g/mol. Its IUPAC name is 4-hydrazinyl-N-(2-methylbutyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-N-(2-methylbutyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80919626 |
| Molecular Formula | C10H17N9 |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 4-hydrazinyl-N-(2-methylbutyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
| SMILES | CCC(C)CNc1nc(NN)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C10H17N9/c1-3-7(2)4-13-8-15-9(18-11)17-10(16-8)19-6-12-5-14-19/h5-7H,3-4,11H2,1-2H3,(H2,13,15,16,17,18) |
| InChIKey | IOJGZUFBHHWAMW-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 119.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|