C9H15N9 — CID 83025136
4-(2,2-dimethylhydrazinyl)-N-ethyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine (PubChem CID 83025136) has the molecular formula C9H15N9 and a molecular weight of 249.28 g/mol. Its IUPAC name is 4-(2,2-dimethylhydrazinyl)-N-ethyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(2,2-dimethylhydrazinyl)-N-ethyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 83025136 |
| Molecular Formula | C9H15N9 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 4-(2,2-dimethylhydrazinyl)-N-ethyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
| SMILES | CCNc1nc(NN(C)C)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C9H15N9/c1-4-11-7-13-8(16-17(2)3)15-9(14-7)18-6-10-5-12-18/h5-6H,4H2,1-3H3,(H2,11,13,14,15,16) |
| InChIKey | KUPYIUXOUYPKSH-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|