C9H16ClN9 — CID 6440128
6-chloro-2-N,4-N-diethyl-1,3,5-triazine-2,4-diamine;1H-1,2,4-triazol-5-amine (PubChem CID 6440128) has the molecular formula C9H16ClN9 and a molecular weight of 285.74 g/mol. Its IUPAC name is 6-chloro-2-N,4-N-diethyl-1,3,5-triazine-2,4-diamine;1H-1,2,4-triazol-5-amine.
| Compound Name | 6-chloro-2-N,4-N-diethyl-1,3,5-triazine-2,4-diamine;1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 6440128 |
| Molecular Formula | C9H16ClN9 |
| Molecular Weight | 285.74 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 6-chloro-2-N,4-N-diethyl-1,3,5-triazine-2,4-diamine;1H-1,2,4-triazol-5-amine |
| SMILES | CCNc1nc(Cl)nc(NCC)n1.Nc1ncn[nH]1 |
| InChI | InChI=1S/C7H12ClN5.C2H4N4/c1-3-9-6-11-5(8)12-7(13-6)10-4-2;3-2-4-1-5-6-2/h3-4H2,1-2H3,(H2,9,10,11,12,13);1H,(H3,3,4,5,6) |
| InChIKey | QRRLMJRIOPVBCX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 130.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.74 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |