C2H4N4 — CID 71313376
(3,5-13C2,1,2-15N2)1H-1,2,4-triazol-5-amine (PubChem CID 71313376) has the molecular formula C2H4N4 and a molecular weight of 88.05 g/mol. Its IUPAC name is (3,5-13C2,1,2-15N2)1H-1,2,4-triazol-5-amine.
| Compound Name | (3,5-13C2,1,2-15N2)1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 71313376 |
| Molecular Formula | C2H4N4 |
| Molecular Weight | 88.05 g/mol |
| Exact Mass | 88.04 |
| IUPAC Name | (3,5-13C2,1,2-15N2)1H-1,2,4-triazol-5-amine |
| SMILES | N[13c]1n[13cH][15n][15nH]1 |
| InChI | InChI=1S/C2H4N4/c3-2-4-1-5-6-2/h1H,(H3,3,4,5,6)/i1+1,2+1,5+1,6+1 |
| InChIKey | KLSJWNVTNUYHDU-MAUGHLKVSA-N |
| XLogP | -0.61 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 88.05 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |