C11H17N9S — CID 80929006
4-hydrazinyl-N-(thian-2-ylmethyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine (PubChem CID 80929006) has the molecular formula C11H17N9S and a molecular weight of 307.39 g/mol. Its IUPAC name is 4-hydrazinyl-N-(thian-2-ylmethyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-N-(thian-2-ylmethyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80929006 |
| Molecular Formula | C11H17N9S |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 4-hydrazinyl-N-(thian-2-ylmethyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
| SMILES | NNc1nc(NCC2CCCCS2)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C11H17N9S/c12-19-10-16-9(14-5-8-3-1-2-4-21-8)17-11(18-10)20-7-13-6-15-20/h6-8H,1-5,12H2,(H2,14,16,17,18,19) |
| InChIKey | SROVCOMUTDRUDL-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 119.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|