C9H13N9O2S — CID 80912949
N-(1,1-dioxothiolan-3-yl)-4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine (PubChem CID 80912949) has the molecular formula C9H13N9O2S and a molecular weight of 311.33 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80912949 |
| Molecular Formula | C9H13N9O2S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
| SMILES | NNc1nc(NC2CCS(=O)(=O)C2)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C9H13N9O2S/c10-17-8-14-7(13-6-1-2-21(19,20)3-6)15-9(16-8)18-5-11-4-12-18/h4-6H,1-3,10H2,(H2,13,14,15,16,17) |
| InChIKey | GLSPPTXMJXWLSG-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 153.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|