C15H24N6O4S — CID 35520657
N-[(3R)-1,1-dioxothiolan-3-yl]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 35520657) has the molecular formula C15H24N6O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 35520657 |
| Molecular Formula | C15H24N6O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | O=S1(=O)CC[C@@H](Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)C1 |
| InChI | InChI=1S/C15H24N6O4S/c22-26(23)10-1-12(11-26)16-13-17-14(20-2-6-24-7-3-20)19-15(18-13)21-4-8-25-9-5-21/h12H,1-11H2,(H,16,17,18,19)/t12-/m1/s1 |
| InChIKey | SPBIJNYPKPVSDV-GFCCVEGCSA-N |
| XLogP | -0.86 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |