C9H14N10 — CID 80918042
[4-piperazin-1-yl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80918042) has the molecular formula C9H14N10 and a molecular weight of 262.28 g/mol. Its IUPAC name is [4-piperazin-1-yl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-piperazin-1-yl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80918042 |
| Molecular Formula | C9H14N10 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | [4-piperazin-1-yl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]hydrazine |
| SMILES | NNc1nc(N2CCNCC2)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C9H14N10/c10-17-7-14-8(18-3-1-11-2-4-18)16-9(15-7)19-6-12-5-13-19/h5-6,11H,1-4,10H2,(H,14,15,16,17) |
| InChIKey | IGUDBCBKUMEUJY-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 122.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|