C13H18N8 — CID 115563123
[4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-6-pyrazol-1-yl-1,3,5-triazin-2-yl]hydrazine (PubChem CID 115563123) has the molecular formula C13H18N8 and a molecular weight of 286.34 g/mol. Its IUPAC name is [4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-6-pyrazol-1-yl-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-6-pyrazol-1-yl-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 115563123 |
| Molecular Formula | C13H18N8 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | [4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-6-pyrazol-1-yl-1,3,5-triazin-2-yl]hydrazine |
| SMILES | NNc1nc(N2CC3CCCC3C2)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C13H18N8/c14-19-11-16-12(18-13(17-11)21-6-2-5-15-21)20-7-9-3-1-4-10(9)8-20/h2,5-6,9-10H,1,3-4,7-8,14H2,(H,16,17,18,19) |
| InChIKey | WBGOSWGYRRNERD-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|