C11H16N8O — CID 80907252
4-hydrazinyl-N-(oxan-4-yl)-6-pyrazol-1-yl-1,3,5-triazin-2-amine (PubChem CID 80907252) has the molecular formula C11H16N8O and a molecular weight of 276.30 g/mol. Its IUPAC name is 4-hydrazinyl-N-(oxan-4-yl)-6-pyrazol-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-N-(oxan-4-yl)-6-pyrazol-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80907252 |
| Molecular Formula | C11H16N8O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 4-hydrazinyl-N-(oxan-4-yl)-6-pyrazol-1-yl-1,3,5-triazin-2-amine |
| SMILES | NNc1nc(NC2CCOCC2)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C11H16N8O/c12-18-10-15-9(14-8-2-6-20-7-3-8)16-11(17-10)19-5-1-4-13-19/h1,4-5,8H,2-3,6-7,12H2,(H2,14,15,16,17,18) |
| InChIKey | KMLUTFCOQVGAKO-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 115.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|