C11H15N7O2 — CID 80913159
[4-(oxolan-2-ylmethoxy)-6-pyrazol-1-yl-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80913159) has the molecular formula C11H15N7O2 and a molecular weight of 277.29 g/mol. Its IUPAC name is [4-(oxolan-2-ylmethoxy)-6-pyrazol-1-yl-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(oxolan-2-ylmethoxy)-6-pyrazol-1-yl-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80913159 |
| Molecular Formula | C11H15N7O2 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | [4-(oxolan-2-ylmethoxy)-6-pyrazol-1-yl-1,3,5-triazin-2-yl]hydrazine |
| SMILES | NNc1nc(OCC2CCCO2)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C11H15N7O2/c12-17-9-14-10(18-5-2-4-13-18)16-11(15-9)20-7-8-3-1-6-19-8/h2,4-5,8H,1,3,6-7,12H2,(H,14,15,16,17) |
| InChIKey | PZGHWRFHPUOZBH-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|