C11H15N7O — CID 106207854
[4-(2-cyclopropylethoxy)-6-pyrazol-1-yl-1,3,5-triazin-2-yl]hydrazine (PubChem CID 106207854) has the molecular formula C11H15N7O and a molecular weight of 261.29 g/mol. Its IUPAC name is [4-(2-cyclopropylethoxy)-6-pyrazol-1-yl-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(2-cyclopropylethoxy)-6-pyrazol-1-yl-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 106207854 |
| Molecular Formula | C11H15N7O |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | [4-(2-cyclopropylethoxy)-6-pyrazol-1-yl-1,3,5-triazin-2-yl]hydrazine |
| SMILES | NNc1nc(OCCC2CC2)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C11H15N7O/c12-17-9-14-10(18-6-1-5-13-18)16-11(15-9)19-7-4-8-2-3-8/h1,5-6,8H,2-4,7,12H2,(H,14,15,16,17) |
| InChIKey | PCEFYGPNGBNIAJ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|