C12H10FN7O — CID 80909244
[4-(2-fluorophenoxy)-6-pyrazol-1-yl-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80909244) has the molecular formula C12H10FN7O and a molecular weight of 287.26 g/mol. Its IUPAC name is [4-(2-fluorophenoxy)-6-pyrazol-1-yl-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(2-fluorophenoxy)-6-pyrazol-1-yl-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80909244 |
| Molecular Formula | C12H10FN7O |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | [4-(2-fluorophenoxy)-6-pyrazol-1-yl-1,3,5-triazin-2-yl]hydrazine |
| SMILES | NNc1nc(Oc2ccccc2F)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C12H10FN7O/c13-8-4-1-2-5-9(8)21-12-17-10(19-14)16-11(18-12)20-7-3-6-15-20/h1-7H,14H2,(H,16,17,18,19) |
| InChIKey | MFYLYRRHCHQBDZ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|