C13H20N6O2 — CID 80879870
N-ethyl-4-(2-propoxyethoxy)-6-pyrazol-1-yl-1,3,5-triazin-2-amine (PubChem CID 80879870) has the molecular formula C13H20N6O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is N-ethyl-4-(2-propoxyethoxy)-6-pyrazol-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-ethyl-4-(2-propoxyethoxy)-6-pyrazol-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80879870 |
| Molecular Formula | C13H20N6O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | N-ethyl-4-(2-propoxyethoxy)-6-pyrazol-1-yl-1,3,5-triazin-2-amine |
| SMILES | CCCOCCOc1nc(NCC)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C13H20N6O2/c1-3-8-20-9-10-21-13-17-11(14-4-2)16-12(18-13)19-7-5-6-15-19/h5-7H,3-4,8-10H2,1-2H3,(H,14,16,17,18) |
| InChIKey | OAULKIPRLLYECR-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|