C11H14ClN5O3 — CID 104561391
2-chloro-4-[2-(2-methoxyethoxy)ethoxy]-6-pyrazol-1-yl-1,3,5-triazine (PubChem CID 104561391) has the molecular formula C11H14ClN5O3 and a molecular weight of 299.72 g/mol. Its IUPAC name is 2-chloro-4-[2-(2-methoxyethoxy)ethoxy]-6-pyrazol-1-yl-1,3,5-triazine.
| Compound Name | 2-chloro-4-[2-(2-methoxyethoxy)ethoxy]-6-pyrazol-1-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 104561391 |
| Molecular Formula | C11H14ClN5O3 |
| Molecular Weight | 299.72 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2-chloro-4-[2-(2-methoxyethoxy)ethoxy]-6-pyrazol-1-yl-1,3,5-triazine |
| SMILES | COCCOCCOc1nc(Cl)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C11H14ClN5O3/c1-18-5-6-19-7-8-20-11-15-9(12)14-10(16-11)17-4-2-3-13-17/h2-4H,5-8H2,1H3 |
| InChIKey | LUPBRPQCKCIWAC-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 84.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.72 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|