About 2-chloro-4-[2-(3-methoxypropoxy)ethoxy]-6-pyrazol-1-yl-1,3,5-triazine
2-chloro-4-[2-(3-methoxypropoxy)ethoxy]-6-pyrazol-1-yl-1,3,5-triazine (PubChem CID 103177489) has the molecular formula C12H16ClN5O3
and a molecular weight of 313.75 g/mol. Its IUPAC name is 2-chloro-4-[2-(3-methoxypropoxy)ethoxy]-6-pyrazol-1-yl-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-chloro-4-[2-(3-methoxypropoxy)ethoxy]-6-pyrazol-1-yl-1,3,5-triazine |
| PubChem CID | 103177489 |
| Molecular Formula | C12H16ClN5O3 |
| Molecular Weight | 313.75 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 2-chloro-4-[2-(3-methoxypropoxy)ethoxy]-6-pyrazol-1-yl-1,3,5-triazine |
| SMILES | COCCCOCCOc1nc(Cl)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C12H16ClN5O3/c1-19-6-3-7-20-8-9-21-12-16-10(13)15-11(17-12)18-5-2-4-14-18/h2,4-5H,3,6-9H2,1H3 |
| InChIKey | SPVOYUXYDZPOTM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 84.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.75 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-[2-(3-methoxypropoxy)ethoxy]-6-pyrazol-1-yl-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-[2-(3-methoxypropoxy)ethoxy]-6-pyrazol-1-yl-1,3,5-triazine?
The IUPAC name of 2-chloro-4-[2-(3-methoxypropoxy)ethoxy]-6-pyrazol-1-yl-1,3,5-triazine (CID 103177489) is 2-chloro-4-[2-(3-methoxypropoxy)ethoxy]-6-pyrazol-1-yl-1,3,5-triazine.
What is the SMILES notation for 2-chloro-4-[2-(3-methoxypropoxy)ethoxy]-6-pyrazol-1-yl-1,3,5-triazine?
The canonical SMILES for 2-chloro-4-[2-(3-methoxypropoxy)ethoxy]-6-pyrazol-1-yl-1,3,5-triazine is COCCCOCCOc1nc(Cl)nc(-n2cccn2)n1.
What is the InChIKey of 2-chloro-4-[2-(3-methoxypropoxy)ethoxy]-6-pyrazol-1-yl-1,3,5-triazine?
The InChIKey is SPVOYUXYDZPOTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClN5O3/c1-19-6-3-7-20-8-9-21-12-16-10(13)15-11(17-12)18-5-2-4-14-18/h2,4-5H,3,6-9H2,1H3.
What are the key properties of 2-chloro-4-[2-(3-methoxypropoxy)ethoxy]-6-pyrazol-1-yl-1,3,5-triazine?
2-chloro-4-[2-(3-methoxypropoxy)ethoxy]-6-pyrazol-1-yl-1,3,5-triazine has a molecular weight of 313.75 g/mol, XLogP of 1.14, 9 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-[2-(3-methoxypropoxy)ethoxy]-6-pyrazol-1-yl-1,3,5-triazine is sourced from PubChem (CID 103177489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).