C12H18N6O3 — CID 103176493
4-imidazol-1-yl-6-[2-(3-methoxypropoxy)ethoxy]-1,3,5-triazin-2-amine (PubChem CID 103176493) has the molecular formula C12H18N6O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 4-imidazol-1-yl-6-[2-(3-methoxypropoxy)ethoxy]-1,3,5-triazin-2-amine.
| Compound Name | 4-imidazol-1-yl-6-[2-(3-methoxypropoxy)ethoxy]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 103176493 |
| Molecular Formula | C12H18N6O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 4-imidazol-1-yl-6-[2-(3-methoxypropoxy)ethoxy]-1,3,5-triazin-2-amine |
| SMILES | COCCCOCCOc1nc(N)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C12H18N6O3/c1-19-5-2-6-20-7-8-21-12-16-10(13)15-11(17-12)18-4-3-14-9-18/h3-4,9H,2,5-8H2,1H3,(H2,13,15,16,17) |
| InChIKey | RBNBPPLUNIHMNH-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 110.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|