C11H16N6O3 — CID 104568284
4-imidazol-1-yl-6-[2-(2-methoxyethoxy)ethoxy]-1,3,5-triazin-2-amine (PubChem CID 104568284) has the molecular formula C11H16N6O3 and a molecular weight of 280.29 g/mol. Its IUPAC name is 4-imidazol-1-yl-6-[2-(2-methoxyethoxy)ethoxy]-1,3,5-triazin-2-amine.
| Compound Name | 4-imidazol-1-yl-6-[2-(2-methoxyethoxy)ethoxy]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 104568284 |
| Molecular Formula | C11H16N6O3 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 4-imidazol-1-yl-6-[2-(2-methoxyethoxy)ethoxy]-1,3,5-triazin-2-amine |
| SMILES | COCCOCCOc1nc(N)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C11H16N6O3/c1-18-4-5-19-6-7-20-11-15-9(12)14-10(16-11)17-3-2-13-8-17/h2-3,8H,4-7H2,1H3,(H2,12,14,15,16) |
| InChIKey | DOXYIFYIEZVCDQ-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 110.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|